C20H18NO4- — CID 23308967
(1S,2S,3S,4S)-3-[[4-(5-methylfuran-2-yl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 23308967) has the molecular formula C20H18NO4- and a molecular weight of 336.37 g/mol. Its IUPAC name is (1S,2S,3S,4S)-3-[[4-(5-methylfuran-2-yl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1S,2S,3S,4S)-3-[[4-(5-methylfuran-2-yl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 23308967 |
| Molecular Formula | C20H18NO4- |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (1S,2S,3S,4S)-3-[[4-(5-methylfuran-2-yl)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | Cc1ccc(-c2ccc(NC(=O)[C@@H]3[C@@H](C(=O)[O-])[C@@H]4C=C[C@@H]3C4)cc2)o1 |
| InChI | InChI=1S/C20H19NO4/c1-11-2-9-16(25-11)12-5-7-15(8-6-12)21-19(22)17-13-3-4-14(10-13)18(17)20(23)24/h2-9,13-14,17-18H,10H2,1H3,(H,21,22)(H,23,24)/p-1/t13-,14-,17+,18+/m1/s1 |
| InChIKey | FKSLNBYCLBTOCK-KNCCTNLNSA-M |
| XLogP | 2.38 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|