C21H16Cl4N2O2 — CID 124776024
(1R,2R,3R,4R)-2-N,3-N-bis(2,4-dichlorophenyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 124776024) has the molecular formula C21H16Cl4N2O2 and a molecular weight of 470.18 g/mol. Its IUPAC name is (1R,2R,3R,4R)-2-N,3-N-bis(2,4-dichlorophenyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4R)-2-N,3-N-bis(2,4-dichlorophenyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 124776024 |
| Molecular Formula | C21H16Cl4N2O2 |
| Molecular Weight | 470.18 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | (1R,2R,3R,4R)-2-N,3-N-bis(2,4-dichlorophenyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)[C@H]1[C@H](C(=O)Nc2ccc(Cl)cc2Cl)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C21H16Cl4N2O2/c22-12-3-5-16(14(24)8-12)26-20(28)18-10-1-2-11(7-10)19(18)21(29)27-17-6-4-13(23)9-15(17)25/h1-6,8-11,18-19H,7H2,(H,26,28)(H,27,29)/t10-,11-,18+,19+/m0/s1 |
| InChIKey | WMSOLZOEXGHKDD-GJBDCUKVSA-N |
| XLogP | 6.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.18 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|