C15H15Cl2NO — CID 98230227
(1S,2R,4R,5S)-N-(2,4-dichlorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 98230227) has the molecular formula C15H15Cl2NO and a molecular weight of 296.20 g/mol. Its IUPAC name is (1S,2R,4R,5S)-N-(2,4-dichlorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide.
| Compound Name | (1S,2R,4R,5S)-N-(2,4-dichlorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
|---|---|
| PubChem CID | 98230227 |
| Molecular Formula | C15H15Cl2NO |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (1S,2R,4R,5S)-N-(2,4-dichlorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)C1[C@@H]2[C@H]3CC[C@@H](C3)[C@@H]12 |
| InChI | InChI=1S/C15H15Cl2NO/c16-9-3-4-11(10(17)6-9)18-15(19)14-12-7-1-2-8(5-7)13(12)14/h3-4,6-8,12-14H,1-2,5H2,(H,18,19)/t7-,8-,12+,13+/m0/s1 |
| InChIKey | KTOXLRYYISIHNX-GYBADROVSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |