C16H19NO2 — CID 103820530
N-(4-hydroxy-2-methylphenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 103820530) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylphenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide.
| Compound Name | N-(4-hydroxy-2-methylphenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
|---|---|
| PubChem CID | 103820530 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-(4-hydroxy-2-methylphenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | Cc1cc(O)ccc1NC(=O)C1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C16H19NO2/c1-8-6-11(18)4-5-12(8)17-16(19)15-13-9-2-3-10(7-9)14(13)15/h4-6,9-10,13-15,18H,2-3,7H2,1H3,(H,17,19) |
| InChIKey | IIQDZDDFGBGBKC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|