C15H15BrFNO — CID 113256407
N-(4-bromo-2-fluorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 113256407) has the molecular formula C15H15BrFNO and a molecular weight of 324.19 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
|---|---|
| PubChem CID | 113256407 |
| Molecular Formula | C15H15BrFNO |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1F)C1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C15H15BrFNO/c16-9-3-4-11(10(17)6-9)18-15(19)14-12-7-1-2-8(5-7)13(12)14/h3-4,6-8,12-14H,1-2,5H2,(H,18,19) |
| InChIKey | VLSMPKZPBQPEQI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |