C11H11BrFNO3S — CID 51534988
(3R)-N-(4-bromo-2-fluorophenyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 51534988) has the molecular formula C11H11BrFNO3S and a molecular weight of 336.18 g/mol. Its IUPAC name is (3R)-N-(4-bromo-2-fluorophenyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3R)-N-(4-bromo-2-fluorophenyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 51534988 |
| Molecular Formula | C11H11BrFNO3S |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | (3R)-N-(4-bromo-2-fluorophenyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1F)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H11BrFNO3S/c12-8-1-2-10(9(13)5-8)14-11(15)7-3-4-18(16,17)6-7/h1-2,5,7H,3-4,6H2,(H,14,15)/t7-/m0/s1 |
| InChIKey | HBKSUNPUDXRWAZ-ZETCQYMHSA-N |
| XLogP | 1.96 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |