C11H13FN2O5S2 — CID 63297241
N-(2-fluoro-4-sulfamoylphenyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 63297241) has the molecular formula C11H13FN2O5S2 and a molecular weight of 336.37 g/mol. Its IUPAC name is N-(2-fluoro-4-sulfamoylphenyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(2-fluoro-4-sulfamoylphenyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 63297241 |
| Molecular Formula | C11H13FN2O5S2 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | N-(2-fluoro-4-sulfamoylphenyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C2CCS(=O)(=O)C2)c(F)c1 |
| InChI | InChI=1S/C11H13FN2O5S2/c12-9-5-8(21(13,18)19)1-2-10(9)14-11(15)7-3-4-20(16,17)6-7/h1-2,5,7H,3-4,6H2,(H,14,15)(H2,13,18,19) |
| InChIKey | NNEZCQCZJBHTSV-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |