C12H15FN2O3S — CID 61129788
N-(2-fluoro-5-sulfamoylphenyl)cyclopentanecarboxamide (PubChem CID 61129788) has the molecular formula C12H15FN2O3S and a molecular weight of 286.33 g/mol. Its IUPAC name is N-(2-fluoro-5-sulfamoylphenyl)cyclopentanecarboxamide.
| Compound Name | N-(2-fluoro-5-sulfamoylphenyl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 61129788 |
| Molecular Formula | C12H15FN2O3S |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-(2-fluoro-5-sulfamoylphenyl)cyclopentanecarboxamide |
| SMILES | NS(=O)(=O)c1ccc(F)c(NC(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C12H15FN2O3S/c13-10-6-5-9(19(14,17)18)7-11(10)15-12(16)8-3-1-2-4-8/h5-8H,1-4H2,(H,15,16)(H2,14,17,18) |
| InChIKey | SIGIOBPZFISTAR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |