C11H14FN3O3S — CID 116658850
1-cyclobutyl-3-(2-fluoro-5-sulfamoylphenyl)urea (PubChem CID 116658850) has the molecular formula C11H14FN3O3S and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-cyclobutyl-3-(2-fluoro-5-sulfamoylphenyl)urea.
| Compound Name | 1-cyclobutyl-3-(2-fluoro-5-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 116658850 |
| Molecular Formula | C11H14FN3O3S |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-cyclobutyl-3-(2-fluoro-5-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccc(F)c(NC(=O)NC2CCC2)c1 |
| InChI | InChI=1S/C11H14FN3O3S/c12-9-5-4-8(19(13,17)18)6-10(9)15-11(16)14-7-2-1-3-7/h4-7H,1-3H2,(H2,13,17,18)(H2,14,15,16) |
| InChIKey | WSXSSDYTBAEXPT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |