C13H16ClFN2O2 — CID 110890882
1-(5-chloro-2-fluorophenyl)-3-(4-hydroxycyclohexyl)urea (PubChem CID 110890882) has the molecular formula C13H16ClFN2O2 and a molecular weight of 286.73 g/mol. Its IUPAC name is 1-(5-chloro-2-fluorophenyl)-3-(4-hydroxycyclohexyl)urea.
| Compound Name | 1-(5-chloro-2-fluorophenyl)-3-(4-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 110890882 |
| Molecular Formula | C13H16ClFN2O2 |
| Molecular Weight | 286.73 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 1-(5-chloro-2-fluorophenyl)-3-(4-hydroxycyclohexyl)urea |
| SMILES | O=C(Nc1cc(Cl)ccc1F)NC1CCC(O)CC1 |
| InChI | InChI=1S/C13H16ClFN2O2/c14-8-1-6-11(15)12(7-8)17-13(19)16-9-2-4-10(18)5-3-9/h1,6-7,9-10,18H,2-5H2,(H2,16,17,19) |
| InChIKey | KLJHIKPUIWOBFH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |