C13H16BrClN2O2 — CID 56824183
1-(5-bromo-2-chlorophenyl)-3-(4-hydroxycyclohexyl)urea (PubChem CID 56824183) has the molecular formula C13H16BrClN2O2 and a molecular weight of 347.64 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorophenyl)-3-(4-hydroxycyclohexyl)urea.
| Compound Name | 1-(5-bromo-2-chlorophenyl)-3-(4-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 56824183 |
| Molecular Formula | C13H16BrClN2O2 |
| Molecular Weight | 347.64 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 1-(5-bromo-2-chlorophenyl)-3-(4-hydroxycyclohexyl)urea |
| SMILES | O=C(Nc1cc(Br)ccc1Cl)NC1CCC(O)CC1 |
| InChI | InChI=1S/C13H16BrClN2O2/c14-8-1-6-11(15)12(7-8)17-13(19)16-9-2-4-10(18)5-3-9/h1,6-7,9-10,18H,2-5H2,(H2,16,17,19) |
| InChIKey | MXUFFCODJWNXGE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |