C12H14Cl2N2O — CID 47192576
1-cyclopentyl-3-(2,5-dichlorophenyl)urea (PubChem CID 47192576) has the molecular formula C12H14Cl2N2O and a molecular weight of 273.16 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,5-dichlorophenyl)urea.
| Compound Name | 1-cyclopentyl-3-(2,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 47192576 |
| Molecular Formula | C12H14Cl2N2O |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-cyclopentyl-3-(2,5-dichlorophenyl)urea |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)NC1CCCC1 |
| InChI | InChI=1S/C12H14Cl2N2O/c13-8-5-6-10(14)11(7-8)16-12(17)15-9-3-1-2-4-9/h5-7,9H,1-4H2,(H2,15,16,17) |
| InChIKey | ADZRYKTZSJEFAW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |