C14H14Cl2N4O — CID 94799051
1-(2,5-dichlorophenyl)-3-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]urea (PubChem CID 94799051) has the molecular formula C14H14Cl2N4O and a molecular weight of 325.20 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]urea |
|---|---|
| PubChem CID | 94799051 |
| Molecular Formula | C14H14Cl2N4O |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]urea |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)N[C@@H]1CCc2nccn2C1 |
| InChI | InChI=1S/C14H14Cl2N4O/c15-9-1-3-11(16)12(7-9)19-14(21)18-10-2-4-13-17-5-6-20(13)8-10/h1,3,5-7,10H,2,4,8H2,(H2,18,19,21)/t10-/m1/s1 |
| InChIKey | LGLRRYJGRXZTMT-SNVBAGLBSA-N |
| XLogP | 3.33 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |