C16H20Cl2N2O2 — CID 108958708
N-cyclopentyl-N'-(2,5-dichlorophenyl)-2,2-dimethylpropanediamide (PubChem CID 108958708) has the molecular formula C16H20Cl2N2O2 and a molecular weight of 343.25 g/mol. Its IUPAC name is N-cyclopentyl-N'-(2,5-dichlorophenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-cyclopentyl-N'-(2,5-dichlorophenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108958708 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-cyclopentyl-N'-(2,5-dichlorophenyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)Nc1cc(Cl)ccc1Cl)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H20Cl2N2O2/c1-16(2,14(21)19-11-5-3-4-6-11)15(22)20-13-9-10(17)7-8-12(13)18/h7-9,11H,3-6H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | KYPGZANIIVYWDD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|