C17H23ClN2O2 — CID 108959020
N-(3-chlorophenyl)-N'-cyclohexyl-2,2-dimethylpropanediamide (PubChem CID 108959020) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N'-cyclohexyl-2,2-dimethylpropanediamide.
| Compound Name | N-(3-chlorophenyl)-N'-cyclohexyl-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108959020 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-(3-chlorophenyl)-N'-cyclohexyl-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)Nc1cccc(Cl)c1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H23ClN2O2/c1-17(2,15(21)19-13-8-4-3-5-9-13)16(22)20-14-10-6-7-12(18)11-14/h6-7,10-11,13H,3-5,8-9H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | GNZMDRGOVAIJBQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|