C22H34N2O2 — CID 108966101
N-(4-tert-butylphenyl)-N'-cycloheptyl-2,2-dimethylpropanediamide (PubChem CID 108966101) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N'-cycloheptyl-2,2-dimethylpropanediamide.
| Compound Name | N-(4-tert-butylphenyl)-N'-cycloheptyl-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108966101 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | N-(4-tert-butylphenyl)-N'-cycloheptyl-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)Nc1ccc(C(C)(C)C)cc1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C22H34N2O2/c1-21(2,3)16-12-14-18(15-13-16)24-20(26)22(4,5)19(25)23-17-10-8-6-7-9-11-17/h12-15,17H,6-11H2,1-5H3,(H,23,25)(H,24,26) |
| InChIKey | JTAKPIYFQFQXND-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|