C24H30N2O3 — CID 108959064
N-cyclohexyl-2,2-dimethyl-N'-(4-phenylmethoxyphenyl)propanediamide (PubChem CID 108959064) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-cyclohexyl-2,2-dimethyl-N'-(4-phenylmethoxyphenyl)propanediamide.
| Compound Name | N-cyclohexyl-2,2-dimethyl-N'-(4-phenylmethoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 108959064 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | N-cyclohexyl-2,2-dimethyl-N'-(4-phenylmethoxyphenyl)propanediamide |
| SMILES | CC(C)(C(=O)Nc1ccc(OCc2ccccc2)cc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C24H30N2O3/c1-24(2,22(27)25-19-11-7-4-8-12-19)23(28)26-20-13-15-21(16-14-20)29-17-18-9-5-3-6-10-18/h3,5-6,9-10,13-16,19H,4,7-8,11-12,17H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | DXIVKFQVSWMSIT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|