C24H33N2O2+ — CID 2317950
cyclooctyl-[(2S)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl]azanium (PubChem CID 2317950) has the molecular formula C24H33N2O2+ and a molecular weight of 381.54 g/mol. Its IUPAC name is cyclooctyl-[(2S)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl]azanium.
| Compound Name | cyclooctyl-[(2S)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 2317950 |
| Molecular Formula | C24H33N2O2+ |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | cyclooctyl-[(2S)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl]azanium |
| SMILES | C[C@H]([NH2+]C1CCCCCCC1)C(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H32N2O2/c1-19(25-21-12-8-3-2-4-9-13-21)24(27)26-22-14-16-23(17-15-22)28-18-20-10-6-5-7-11-20/h5-7,10-11,14-17,19,21,25H,2-4,8-9,12-13,18H2,1H3,(H,26,27)/p+1/t19-/m0/s1 |
| InChIKey | HVMQQUKYXHKFPV-IBGZPJMESA-O |
| XLogP | 4.27 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |