C21H23N2O3+ — CID 9466817
furan-2-ylmethyl-[(2S)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl]azanium (PubChem CID 9466817) has the molecular formula C21H23N2O3+ and a molecular weight of 351.43 g/mol. Its IUPAC name is furan-2-ylmethyl-[(2S)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl]azanium.
| Compound Name | furan-2-ylmethyl-[(2S)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 9466817 |
| Molecular Formula | C21H23N2O3+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | furan-2-ylmethyl-[(2S)-1-oxo-1-(4-phenylmethoxyanilino)propan-2-yl]azanium |
| SMILES | C[C@H]([NH2+]Cc1ccco1)C(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H22N2O3/c1-16(22-14-20-8-5-13-25-20)21(24)23-18-9-11-19(12-10-18)26-15-17-6-3-2-4-7-17/h2-13,16,22H,14-15H2,1H3,(H,23,24)/p+1/t16-/m0/s1 |
| InChIKey | NILFEDOGLZEEKG-INIZCTEOSA-O |
| XLogP | 2.95 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |