C20H27N2O+ — CID 2533830
benzyl-[(2S)-1-(4-tert-butylanilino)-1-oxopropan-2-yl]azanium (PubChem CID 2533830) has the molecular formula C20H27N2O+ and a molecular weight of 311.45 g/mol. Its IUPAC name is benzyl-[(2S)-1-(4-tert-butylanilino)-1-oxopropan-2-yl]azanium.
| Compound Name | benzyl-[(2S)-1-(4-tert-butylanilino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 2533830 |
| Molecular Formula | C20H27N2O+ |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | benzyl-[(2S)-1-(4-tert-butylanilino)-1-oxopropan-2-yl]azanium |
| SMILES | C[C@H]([NH2+]Cc1ccccc1)C(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H26N2O/c1-15(21-14-16-8-6-5-7-9-16)19(23)22-18-12-10-17(11-13-18)20(2,3)4/h5-13,15,21H,14H2,1-4H3,(H,22,23)/p+1/t15-/m0/s1 |
| InChIKey | RFEYJAUQEFHKPM-HNNXBMFYSA-O |
| XLogP | 3.07 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |