C17H21N2O+ — CID 7160969
(4-acetamidophenyl)methyl-[(1R)-1-phenylethyl]azanium (PubChem CID 7160969) has the molecular formula C17H21N2O+ and a molecular weight of 269.37 g/mol. Its IUPAC name is (4-acetamidophenyl)methyl-[(1R)-1-phenylethyl]azanium.
| Compound Name | (4-acetamidophenyl)methyl-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 7160969 |
| Molecular Formula | C17H21N2O+ |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (4-acetamidophenyl)methyl-[(1R)-1-phenylethyl]azanium |
| SMILES | CC(=O)Nc1ccc(C[NH2+][C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2O/c1-13(16-6-4-3-5-7-16)18-12-15-8-10-17(11-9-15)19-14(2)20/h3-11,13,18H,12H2,1-2H3,(H,19,20)/p+1/t13-/m1/s1 |
| InChIKey | HQIQIUMHJFEKMN-CYBMUJFWSA-O |
| XLogP | 2.47 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |