C17H19NO4P- — CID 5289359
(4-acetamidophenyl)methyl-[(1S)-1-phenylethoxy]phosphinate (PubChem CID 5289359) has the molecular formula C17H19NO4P- and a molecular weight of 332.32 g/mol. Its IUPAC name is (4-acetamidophenyl)methyl-[(1S)-1-phenylethoxy]phosphinate.
| Compound Name | (4-acetamidophenyl)methyl-[(1S)-1-phenylethoxy]phosphinate |
|---|---|
| PubChem CID | 5289359 |
| Molecular Formula | C17H19NO4P- |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (4-acetamidophenyl)methyl-[(1S)-1-phenylethoxy]phosphinate |
| SMILES | CC(=O)Nc1ccc(CP(=O)([O-])O[C@@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H20NO4P/c1-13(16-6-4-3-5-7-16)22-23(20,21)12-15-8-10-17(11-9-15)18-14(2)19/h3-11,13H,12H2,1-2H3,(H,18,19)(H,20,21)/p-1/t13-/m0/s1 |
| InChIKey | YPTMOJMDCPUCJT-ZDUSSCGKSA-M |
| XLogP | 3.48 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|