C24H22N2O4 — CID 8578956
[2-(4-acetamidoanilino)-2-oxoethyl] 2,2-diphenylacetate (PubChem CID 8578956) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 2,2-diphenylacetate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 8578956 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2,2-diphenylacetate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O4/c1-17(27)25-20-12-14-21(15-13-20)26-22(28)16-30-24(29)23(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,23H,16H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | NKNYAGTWPZDLLC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |