C25H23NO3 — CID 7749895
[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 2,2-diphenylacetate (PubChem CID 7749895) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 2,2-diphenylacetate.
| Compound Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 7749895 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 2,2-diphenylacetate |
| SMILES | O=C(COC(=O)C(c1ccccc1)c1ccccc1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C25H23NO3/c27-23(26-22-15-14-18-12-7-13-21(18)16-22)17-29-25(28)24(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-6,8-11,14-16,24H,7,12-13,17H2,(H,26,27) |
| InChIKey | LLVJQLSJVXRJKB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |