C24H23NOS2 — CID 123563159
N-(2,3-dihydro-1H-inden-5-yl)-3,3-bis(phenylsulfanyl)propanamide (PubChem CID 123563159) has the molecular formula C24H23NOS2 and a molecular weight of 405.59 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-3,3-bis(phenylsulfanyl)propanamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-3,3-bis(phenylsulfanyl)propanamide |
|---|---|
| PubChem CID | 123563159 |
| Molecular Formula | C24H23NOS2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-3,3-bis(phenylsulfanyl)propanamide |
| SMILES | O=C(CC(Sc1ccccc1)Sc1ccccc1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C24H23NOS2/c26-23(25-20-15-14-18-8-7-9-19(18)16-20)17-24(27-21-10-3-1-4-11-21)28-22-12-5-2-6-13-22/h1-6,10-16,24H,7-9,17H2,(H,25,26) |
| InChIKey | STWCACIJUFHXSU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|