C26H21F6NOS2 — CID 123632016
N-(2,3-dihydro-1H-inden-5-yl)-3,3-bis[[3-(trifluoromethyl)phenyl]sulfanyl]propanamide (PubChem CID 123632016) has the molecular formula C26H21F6NOS2 and a molecular weight of 541.58 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-3,3-bis[[3-(trifluoromethyl)phenyl]sulfanyl]propanamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-3,3-bis[[3-(trifluoromethyl)phenyl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 123632016 |
| Molecular Formula | C26H21F6NOS2 |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-3,3-bis[[3-(trifluoromethyl)phenyl]sulfanyl]propanamide |
| SMILES | O=C(CC(Sc1cccc(C(F)(F)F)c1)Sc1cccc(C(F)(F)F)c1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C26H21F6NOS2/c27-25(28,29)18-6-2-8-21(13-18)35-24(36-22-9-3-7-19(14-22)26(30,31)32)15-23(34)33-20-11-10-16-4-1-5-17(16)12-20/h2-3,6-14,24H,1,4-5,15H2,(H,33,34) |
| InChIKey | HAGZENGLJLUVGI-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|