C12H16N4OS — CID 77060779
[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] N'-aminocarbamimidothioate (PubChem CID 77060779) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] N'-aminocarbamimidothioate.
| Compound Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 77060779 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SCC(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C12H16N4OS/c13-12(16-14)18-7-11(17)15-10-5-4-8-2-1-3-9(8)6-10/h4-6H,1-3,7,14H2,(H2,13,16)(H,15,17) |
| InChIKey | KJIRNAIEEQFCKE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|