C17H13F6NOS — CID 7484755
(2S)-N-[4-(trifluoromethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]sulfanylpropanamide (PubChem CID 7484755) has the molecular formula C17H13F6NOS and a molecular weight of 393.35 g/mol. Its IUPAC name is (2S)-N-[4-(trifluoromethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]sulfanylpropanamide.
| Compound Name | (2S)-N-[4-(trifluoromethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7484755 |
| Molecular Formula | C17H13F6NOS |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (2S)-N-[4-(trifluoromethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]sulfanylpropanamide |
| SMILES | C[C@H](Sc1cccc(C(F)(F)F)c1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F6NOS/c1-10(26-14-4-2-3-12(9-14)17(21,22)23)15(25)24-13-7-5-11(6-8-13)16(18,19)20/h2-10H,1H3,(H,24,25)/t10-/m0/s1 |
| InChIKey | VCIZMXXXPAXBTK-JTQLQIEISA-N |
| XLogP | 5.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |