C10H11F3N2OS — CID 63580292
2-[3-(trifluoromethyl)phenyl]sulfanylpropanehydrazide (PubChem CID 63580292) has the molecular formula C10H11F3N2OS and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]sulfanylpropanehydrazide.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]sulfanylpropanehydrazide |
|---|---|
| PubChem CID | 63580292 |
| Molecular Formula | C10H11F3N2OS |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]sulfanylpropanehydrazide |
| SMILES | CC(Sc1cccc(C(F)(F)F)c1)C(=O)NN |
| InChI | InChI=1S/C10H11F3N2OS/c1-6(9(16)15-14)17-8-4-2-3-7(5-8)10(11,12)13/h2-6H,14H2,1H3,(H,15,16) |
| InChIKey | GXQWCTMUWLNCOL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|