C17H15ClF3NOS — CID 99864872
(2R)-2-(4-chlorophenyl)sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 99864872) has the molecular formula C17H15ClF3NOS and a molecular weight of 373.83 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 99864872 |
| Molecular Formula | C17H15ClF3NOS |
| Molecular Weight | 373.83 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | C[C@@H](Sc1ccc(Cl)cc1)C(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15ClF3NOS/c1-11(24-15-7-5-14(18)6-8-15)16(23)22-10-12-3-2-4-13(9-12)17(19,20)21/h2-9,11H,10H2,1H3,(H,22,23)/t11-/m1/s1 |
| InChIKey | SCSHRDRDAUTHLE-LLVKDONJSA-N |
| XLogP | 5.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.83 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |