C18H17ClF3NOS — CID 100546639
(2R)-2-(4-chlorophenyl)sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide (PubChem CID 100546639) has the molecular formula C18H17ClF3NOS and a molecular weight of 387.85 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 100546639 |
| Molecular Formula | C18H17ClF3NOS |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide |
| SMILES | CC[C@@H](Sc1ccc(Cl)cc1)C(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17ClF3NOS/c1-2-16(25-15-8-6-14(19)7-9-15)17(24)23-11-12-4-3-5-13(10-12)18(20,21)22/h3-10,16H,2,11H2,1H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | UBCITPNKJHATBT-MRXNPFEDSA-N |
| XLogP | 5.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |