C20H24ClNO4S — CID 132663545
2-(4-chlorophenyl)sulfanyl-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide (PubChem CID 132663545) has the molecular formula C20H24ClNO4S and a molecular weight of 409.94 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 132663545 |
| Molecular Formula | C20H24ClNO4S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide |
| SMILES | CCC(Sc1ccc(Cl)cc1)C(=O)NCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H24ClNO4S/c1-5-18(27-15-8-6-14(21)7-9-15)20(23)22-12-13-10-16(24-2)19(26-4)17(11-13)25-3/h6-11,18H,5,12H2,1-4H3,(H,22,23) |
| InChIKey | RRVREPJDAZUBFE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |