C17H17Cl2NO2S — CID 28631688
(2R)-N-(3-chloro-4-methoxyphenyl)-2-(4-chlorophenyl)sulfanylbutanamide (PubChem CID 28631688) has the molecular formula C17H17Cl2NO2S and a molecular weight of 370.30 g/mol. Its IUPAC name is (2R)-N-(3-chloro-4-methoxyphenyl)-2-(4-chlorophenyl)sulfanylbutanamide.
| Compound Name | (2R)-N-(3-chloro-4-methoxyphenyl)-2-(4-chlorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 28631688 |
| Molecular Formula | C17H17Cl2NO2S |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | (2R)-N-(3-chloro-4-methoxyphenyl)-2-(4-chlorophenyl)sulfanylbutanamide |
| SMILES | CC[C@@H](Sc1ccc(Cl)cc1)C(=O)Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2NO2S/c1-3-16(23-13-7-4-11(18)5-8-13)17(21)20-12-6-9-15(22-2)14(19)10-12/h4-10,16H,3H2,1-2H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | RQNUKOMSDPPWSQ-MRXNPFEDSA-N |
| XLogP | 5.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |