C18H20ClNO3S — CID 30390941
(2R)-2-(4-chlorophenyl)sulfanyl-N-(2,5-dimethoxyphenyl)butanamide (PubChem CID 30390941) has the molecular formula C18H20ClNO3S and a molecular weight of 365.88 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)sulfanyl-N-(2,5-dimethoxyphenyl)butanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-(2,5-dimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 30390941 |
| Molecular Formula | C18H20ClNO3S |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-(2,5-dimethoxyphenyl)butanamide |
| SMILES | CC[C@@H](Sc1ccc(Cl)cc1)C(=O)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C18H20ClNO3S/c1-4-17(24-14-8-5-12(19)6-9-14)18(21)20-15-11-13(22-2)7-10-16(15)23-3/h5-11,17H,4H2,1-3H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | YHTXJGSZUSQVSQ-QGZVFWFLSA-N |
| XLogP | 4.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |