C11H12F2O2S — CID 105425708
2,2-difluoro-2-(3-propan-2-ylsulfanylphenyl)acetic acid (PubChem CID 105425708) has the molecular formula C11H12F2O2S and a molecular weight of 246.28 g/mol. Its IUPAC name is 2,2-difluoro-2-(3-propan-2-ylsulfanylphenyl)acetic acid.
| Compound Name | 2,2-difluoro-2-(3-propan-2-ylsulfanylphenyl)acetic acid |
|---|---|
| PubChem CID | 105425708 |
| Molecular Formula | C11H12F2O2S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2,2-difluoro-2-(3-propan-2-ylsulfanylphenyl)acetic acid |
| SMILES | CC(C)Sc1cccc(C(F)(F)C(=O)O)c1 |
| InChI | InChI=1S/C11H12F2O2S/c1-7(2)16-9-5-3-4-8(6-9)11(12,13)10(14)15/h3-7H,1-2H3,(H,14,15) |
| InChIKey | ZHWVYDXBHUPLRV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |