2,2-difluoro-2-phenylacetic acid;silver

C8H6AgF2O2 — CID 87172236

IUPAC2,2-difluoro-2-phenylacetic acid;silver
SMILESO=C(O)C(F)(F)c1ccccc1.[Ag]
InChIInChI=1S/C8H6F2O2.Ag/c9-8(10,7(11)12)6-4-2-1-3-5-6;/h1-5H,(H,11,12);
InChIKeyFYFDBAJUKRUZFS-UHFFFAOYSA-N
MW280.00 g/mol
LogP1.86
Rot. Bonds2

About 2,2-difluoro-2-phenylacetic acid;silver

2,2-difluoro-2-phenylacetic acid;silver (PubChem CID 87172236) has the molecular formula C8H6AgF2O2 and a molecular weight of 280.00 g/mol. Its IUPAC name is 2,2-difluoro-2-phenylacetic acid;silver.

Molecular Properties

Compound Name2,2-difluoro-2-phenylacetic acid;silver
PubChem CID87172236
Molecular FormulaC8H6AgF2O2
Molecular Weight280.00 g/mol
Exact Mass278.94
IUPAC Name2,2-difluoro-2-phenylacetic acid;silver
SMILESO=C(O)C(F)(F)c1ccccc1.[Ag]
InChIInChI=1S/C8H6F2O2.Ag/c9-8(10,7(11)12)6-4-2-1-3-5-6;/h1-5H,(H,11,12);
InChIKeyFYFDBAJUKRUZFS-UHFFFAOYSA-N
XLogP1.86
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.00
LogP ≤ 51.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2,2-difluoro-2-phenylacetic acid;silver with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(3-tert-butylphenyl)-2,2-difluoroacetic acid
CID 105425731
1,1,3-trifluoro-1-phenylpropan-2-one
CID 175143665
2,2-difluoro-2-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]acetic acid
CID 162738000
2-(3-bromophenyl)-2,2-difluoroacetic acid
CID 28740330
2-(4-ethenylphenyl)-2,2-difluoroacetic acid
CID 154126717
2,2-difluoro-2-[3-(trifluoromethoxy)phenyl]acetic acid
CID 62916357
2,2-difluoro-2-(2-fluorophenyl)acetic acid
CID 62492425
(2R,3R)-2,3-dihydroxy-2,3-diphenylbutanedioic acid
CID 101336799
(2S,3S)-2,3-dihydroxy-2,3-diphenylbutanedioic acid
CID 101336800
2-(3,4-dimethylphenyl)-2,2-difluoroacetic acid
CID 39058323
1,1-difluoro-1-(4-phenylphenyl)propan-2-one
CID 71022279
2,2-difluoro-2-[4-(4-methoxyphenyl)phenyl]acetic acid
CID 22575053

Frequently Asked Questions

What is the IUPAC name of 2,2-difluoro-2-phenylacetic acid;silver?
The IUPAC name of 2,2-difluoro-2-phenylacetic acid;silver (CID 87172236) is 2,2-difluoro-2-phenylacetic acid;silver.
What is the SMILES notation for 2,2-difluoro-2-phenylacetic acid;silver?
The canonical SMILES for 2,2-difluoro-2-phenylacetic acid;silver is O=C(O)C(F)(F)c1ccccc1.[Ag].
What is the InChIKey of 2,2-difluoro-2-phenylacetic acid;silver?
The InChIKey is FYFDBAJUKRUZFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F2O2.Ag/c9-8(10,7(11)12)6-4-2-1-3-5-6;/h1-5H,(H,11,12);.
What are the key properties of 2,2-difluoro-2-phenylacetic acid;silver?
2,2-difluoro-2-phenylacetic acid;silver has a molecular weight of 280.00 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-2-phenylacetic acid;silver is sourced from PubChem (CID 87172236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).