C10H8F2O2 — CID 154126717
2-(4-ethenylphenyl)-2,2-difluoroacetic acid (PubChem CID 154126717) has the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)-2,2-difluoroacetic acid.
| Compound Name | 2-(4-ethenylphenyl)-2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 154126717 |
| Molecular Formula | C10H8F2O2 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-(4-ethenylphenyl)-2,2-difluoroacetic acid |
| SMILES | C=Cc1ccc(C(F)(F)C(=O)O)cc1 |
| InChI | InChI=1S/C10H8F2O2/c1-2-7-3-5-8(6-4-7)10(11,12)9(13)14/h2-6H,1H2,(H,13,14) |
| InChIKey | ZJXNQZJUAKWKDT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |