C10H10F2O3S — CID 159575348
carbanylium;(4-ethenylphenyl)-difluoromethanesulfonate (PubChem CID 159575348) has the molecular formula C10H10F2O3S and a molecular weight of 248.25 g/mol. Its IUPAC name is carbanylium;(4-ethenylphenyl)-difluoromethanesulfonate.
| Compound Name | carbanylium;(4-ethenylphenyl)-difluoromethanesulfonate |
|---|---|
| PubChem CID | 159575348 |
| Molecular Formula | C10H10F2O3S |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | carbanylium;(4-ethenylphenyl)-difluoromethanesulfonate |
| SMILES | C=Cc1ccc(C(F)(F)S(=O)(=O)[O-])cc1.[CH3+] |
| InChI | InChI=1S/C9H8F2O3S.CH3/c1-2-7-3-5-8(6-4-7)9(10,11)15(12,13)14;/h2-6H,1H2,(H,12,13,14);1H3/q;+1/p-1 |
| InChIKey | MIIJEHOGHLTOME-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|