C10H7F2O6S- — CID 140648641
(4-ethenylphenoxy)carbonyloxy-difluoromethanesulfonate (PubChem CID 140648641) has the molecular formula C10H7F2O6S- and a molecular weight of 293.22 g/mol. Its IUPAC name is (4-ethenylphenoxy)carbonyloxy-difluoromethanesulfonate.
| Compound Name | (4-ethenylphenoxy)carbonyloxy-difluoromethanesulfonate |
|---|---|
| PubChem CID | 140648641 |
| Molecular Formula | C10H7F2O6S- |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | (4-ethenylphenoxy)carbonyloxy-difluoromethanesulfonate |
| SMILES | C=Cc1ccc(OC(=O)OC(F)(F)S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C10H8F2O6S/c1-2-7-3-5-8(6-4-7)17-9(13)18-10(11,12)19(14,15)16/h2-6H,1H2,(H,14,15,16)/p-1 |
| InChIKey | NOUQTTWSXHPIGX-UHFFFAOYSA-M |
| XLogP | 1.94 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|