C17H12F5O6S- — CID 140648594
2-[2-(6-ethenylnaphthalen-2-yl)oxy-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonate (PubChem CID 140648594) has the molecular formula C17H12F5O6S- and a molecular weight of 439.33 g/mol. Its IUPAC name is 2-[2-(6-ethenylnaphthalen-2-yl)oxy-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonate.
| Compound Name | 2-[2-(6-ethenylnaphthalen-2-yl)oxy-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 140648594 |
| Molecular Formula | C17H12F5O6S- |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 2-[2-(6-ethenylnaphthalen-2-yl)oxy-2-oxoethoxy]-1,1,3,3,3-pentafluoropropane-1-sulfonate |
| SMILES | C=Cc1ccc2cc(OC(=O)COC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])ccc2c1 |
| InChI | InChI=1S/C17H13F5O6S/c1-2-10-3-4-12-8-13(6-5-11(12)7-10)28-14(23)9-27-15(16(18,19)20)17(21,22)29(24,25)26/h2-8,15H,1,9H2,(H,24,25,26)/p-1 |
| InChIKey | FISMPSNOGBZGDC-UHFFFAOYSA-M |
| XLogP | 3.47 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|