C12H7F2O6S- — CID 140670191
1,1-difluoro-2-(6-hydroxynaphthalen-2-yl)oxy-2-oxoethanesulfonate (PubChem CID 140670191) has the molecular formula C12H7F2O6S- and a molecular weight of 317.25 g/mol. Its IUPAC name is 1,1-difluoro-2-(6-hydroxynaphthalen-2-yl)oxy-2-oxoethanesulfonate.
| Compound Name | 1,1-difluoro-2-(6-hydroxynaphthalen-2-yl)oxy-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 140670191 |
| Molecular Formula | C12H7F2O6S- |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 1,1-difluoro-2-(6-hydroxynaphthalen-2-yl)oxy-2-oxoethanesulfonate |
| SMILES | O=C(Oc1ccc2cc(O)ccc2c1)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C12H8F2O6S/c13-12(14,21(17,18)19)11(16)20-10-4-2-7-5-9(15)3-1-8(7)6-10/h1-6,15H,(H,17,18,19)/p-1 |
| InChIKey | HQXVDZXPIRMRHR-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|