C20H19F2O8STe- — CID 165156294
1,1-difluoro-2-[4-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]tellanylphenoxy]-2-oxoethanesulfonate (PubChem CID 165156294) has the molecular formula C20H19F2O8STe- and a molecular weight of 585.03 g/mol. Its IUPAC name is 1,1-difluoro-2-[4-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]tellanylphenoxy]-2-oxoethanesulfonate.
| Compound Name | 1,1-difluoro-2-[4-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]tellanylphenoxy]-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 165156294 |
| Molecular Formula | C20H19F2O8STe- |
| Molecular Weight | 585.03 g/mol |
| Exact Mass | 586.98 |
| IUPAC Name | 1,1-difluoro-2-[4-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]tellanylphenoxy]-2-oxoethanesulfonate |
| SMILES | CC(C)(C)OC(=O)COc1ccc([Te]c2ccc(OC(=O)C(F)(F)S(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H20F2O8STe/c1-19(2,3)30-17(23)12-28-13-4-8-15(9-5-13)32-16-10-6-14(7-11-16)29-18(24)20(21,22)31(25,26)27/h4-11H,12H2,1-3H3,(H,25,26,27)/p-1 |
| InChIKey | XVFXHKVVZUVIAD-UHFFFAOYSA-M |
| XLogP | 1.11 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.03 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|