C20H23F3O6S2 — CID 171928216
tert-butyl 2-[4-(trifluoromethylsulfonyloxy)phenoxy]acetate;3-methylbenzenethiol (PubChem CID 171928216) has the molecular formula C20H23F3O6S2 and a molecular weight of 480.53 g/mol. Its IUPAC name is tert-butyl 2-[4-(trifluoromethylsulfonyloxy)phenoxy]acetate;3-methylbenzenethiol.
| Compound Name | tert-butyl 2-[4-(trifluoromethylsulfonyloxy)phenoxy]acetate;3-methylbenzenethiol |
|---|---|
| PubChem CID | 171928216 |
| Molecular Formula | C20H23F3O6S2 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | tert-butyl 2-[4-(trifluoromethylsulfonyloxy)phenoxy]acetate;3-methylbenzenethiol |
| SMILES | CC(C)(C)OC(=O)COc1ccc(OS(=O)(=O)C(F)(F)F)cc1.Cc1cccc(S)c1 |
| InChI | InChI=1S/C13H15F3O6S.C7H8S/c1-12(2,3)21-11(17)8-20-9-4-6-10(7-5-9)22-23(18,19)13(14,15)16;1-6-3-2-4-7(8)5-6/h4-7H,8H2,1-3H3;2-5,8H,1H3 |
| InChIKey | DDPHIBDLLHKPJX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|