C38H48O9 — CID 23023013
tert-butyl 2-[4-[1,1-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]ethyl]phenoxy]acetate (PubChem CID 23023013) has the molecular formula C38H48O9 and a molecular weight of 648.79 g/mol. Its IUPAC name is tert-butyl 2-[4-[1,1-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]ethyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[1,1-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]ethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 23023013 |
| Molecular Formula | C38H48O9 |
| Molecular Weight | 648.79 g/mol |
| Exact Mass | 648.33 |
| IUPAC Name | tert-butyl 2-[4-[1,1-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]ethyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(C(C)(c2ccc(OCC(=O)OC(C)(C)C)cc2)c2ccc(OCC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C38H48O9/c1-35(2,3)45-32(39)23-42-29-17-11-26(12-18-29)38(10,27-13-19-30(20-14-27)43-24-33(40)46-36(4,5)6)28-15-21-31(22-16-28)44-25-34(41)47-37(7,8)9/h11-22H,23-25H2,1-10H3 |
| InChIKey | KOTHGODKHZYLAP-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.79 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|