C29H30O9 — CID 11519263
methyl 2-[4-[1,1-bis[4-(2-methoxy-2-oxoethoxy)phenyl]ethyl]phenoxy]acetate (PubChem CID 11519263) has the molecular formula C29H30O9 and a molecular weight of 522.55 g/mol. Its IUPAC name is methyl 2-[4-[1,1-bis[4-(2-methoxy-2-oxoethoxy)phenyl]ethyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[1,1-bis[4-(2-methoxy-2-oxoethoxy)phenyl]ethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 11519263 |
| Molecular Formula | C29H30O9 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | methyl 2-[4-[1,1-bis[4-(2-methoxy-2-oxoethoxy)phenyl]ethyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C(C)(c2ccc(OCC(=O)OC)cc2)c2ccc(OCC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C29H30O9/c1-29(20-5-11-23(12-6-20)36-17-26(30)33-2,21-7-13-24(14-8-21)37-18-27(31)34-3)22-9-15-25(16-10-22)38-19-28(32)35-4/h5-16H,17-19H2,1-4H3 |
| InChIKey | ODTZCWXPSCMRBE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|