C33H38O9 — CID 25126559
ethyl 3-[4-[1,1-bis[4-(2-ethoxy-2-oxoethoxy)phenyl]ethyl]phenoxy]propanoate (PubChem CID 25126559) has the molecular formula C33H38O9 and a molecular weight of 578.66 g/mol. Its IUPAC name is ethyl 3-[4-[1,1-bis[4-(2-ethoxy-2-oxoethoxy)phenyl]ethyl]phenoxy]propanoate.
| Compound Name | ethyl 3-[4-[1,1-bis[4-(2-ethoxy-2-oxoethoxy)phenyl]ethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 25126559 |
| Molecular Formula | C33H38O9 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | ethyl 3-[4-[1,1-bis[4-(2-ethoxy-2-oxoethoxy)phenyl]ethyl]phenoxy]propanoate |
| SMILES | CCOC(=O)CCOc1ccc(C(C)(c2ccc(OCC(=O)OCC)cc2)c2ccc(OCC(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C33H38O9/c1-5-37-30(34)20-21-40-27-14-8-24(9-15-27)33(4,25-10-16-28(17-11-25)41-22-31(35)38-6-2)26-12-18-29(19-13-26)42-23-32(36)39-7-3/h8-19H,5-7,20-23H2,1-4H3 |
| InChIKey | MZWHZANSFVYHKB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|