C15H12F3NO4 — CID 139703755
methyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]acetate (PubChem CID 139703755) has the molecular formula C15H12F3NO4 and a molecular weight of 327.26 g/mol. Its IUPAC name is methyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]acetate.
| Compound Name | methyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]acetate |
|---|---|
| PubChem CID | 139703755 |
| Molecular Formula | C15H12F3NO4 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | methyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(Oc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C15H12F3NO4/c1-21-14(20)9-22-11-3-5-12(6-4-11)23-13-7-2-10(8-19-13)15(16,17)18/h2-8H,9H2,1H3 |
| InChIKey | VMYHCWKOLPRIQE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |