C23H20F3N3O5 — CID 24532076
N'-[2-(2-ethoxyphenoxy)acetyl]-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzohydrazide (PubChem CID 24532076) has the molecular formula C23H20F3N3O5 and a molecular weight of 475.42 g/mol. Its IUPAC name is N'-[2-(2-ethoxyphenoxy)acetyl]-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzohydrazide.
| Compound Name | N'-[2-(2-ethoxyphenoxy)acetyl]-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzohydrazide |
|---|---|
| PubChem CID | 24532076 |
| Molecular Formula | C23H20F3N3O5 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | N'-[2-(2-ethoxyphenoxy)acetyl]-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzohydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)c1ccc(Oc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C23H20F3N3O5/c1-2-32-18-5-3-4-6-19(18)33-14-20(30)28-29-22(31)15-7-10-17(11-8-15)34-21-12-9-16(13-27-21)23(24,25)26/h3-13H,2,14H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | MFIAZJSTQYXBEA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|