About methyl 2-pyridin-4-yloxyacetate
methyl 2-pyridin-4-yloxyacetate (PubChem CID 90026078) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is methyl 2-pyridin-4-yloxyacetate.
Molecular Properties
| Compound Name | methyl 2-pyridin-4-yloxyacetate |
| PubChem CID | 90026078 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | methyl 2-pyridin-4-yloxyacetate |
| SMILES | COC(=O)COc1ccncc1 |
| InChI | InChI=1S/C8H9NO3/c1-11-8(10)6-12-7-2-4-9-5-3-7/h2-5H,6H2,1H3 |
| InChIKey | ZBFQDVQGABGHIP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-pyridin-4-yloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-pyridin-4-yloxyacetate?
The IUPAC name of methyl 2-pyridin-4-yloxyacetate (CID 90026078) is methyl 2-pyridin-4-yloxyacetate.
What is the SMILES notation for methyl 2-pyridin-4-yloxyacetate?
The canonical SMILES for methyl 2-pyridin-4-yloxyacetate is COC(=O)COc1ccncc1.
What is the InChIKey of methyl 2-pyridin-4-yloxyacetate?
The InChIKey is ZBFQDVQGABGHIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c1-11-8(10)6-12-7-2-4-9-5-3-7/h2-5H,6H2,1H3.
What are the key properties of methyl 2-pyridin-4-yloxyacetate?
methyl 2-pyridin-4-yloxyacetate has a molecular weight of 167.16 g/mol, XLogP of 0.63, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-pyridin-4-yloxyacetate is sourced from PubChem (CID 90026078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).