C16H24O3 — CID 18731020
tert-butyl 2-(4-butan-2-ylphenoxy)acetate (PubChem CID 18731020) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is tert-butyl 2-(4-butan-2-ylphenoxy)acetate.
| Compound Name | tert-butyl 2-(4-butan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 18731020 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | tert-butyl 2-(4-butan-2-ylphenoxy)acetate |
| SMILES | CCC(C)c1ccc(OCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24O3/c1-6-12(2)13-7-9-14(10-8-13)18-11-15(17)19-16(3,4)5/h7-10,12H,6,11H2,1-5H3 |
| InChIKey | NLAVFOHMCAUVQM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |